Ürolitin B (1139-83-9) Üretici fabrika

Ürolitin B

Kasım 9, 2020

Ürolitin BSzellikler

Adı: Ürolitin B
Kimyasal ad: 3-Hidroksi-6H-dibenzo [b, d] piran-6-on
CAS: 1139-83-9
Kimyasal formülü: C13H8O3
Moleküler ağırlık: X
Renk:  Beyaz toz
InChi Anahtarı: WXUQMTRHPNOXBV-UHFFFAOYSA-N-
SMILES Kodu: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Fonksiyon: Ürolitin B, mitokondriyal ve kas fonksiyonunu iyileştirebilir.

Ürolitin B, yaşlanma sırasında kas gücünü ve dayanıklılığı artırabilir.

Uygulama: Ürolitin B, ellagitannisin bağırsak mikrobiyal metabolitidir ve tahlil sistemi ve koşullarına bağlı olarak güçlü antioksidan ve pro-oksidan aktiviteler sergiler. Ürolitin B ayrıca östrojenik ve / veya anti-östrojenik aktivite gösterebilir.
Çözünürlük: N, N-dimetilformamid ve dimetilmetilen içinde kolayca çözünür. Metanol, etanol ve etil asetatta az çözünür sülfon
Depolama Sıcaklığı: Higroskopik, -20 ° C Soğutucu, Atıl atmosfer altında
Nakliye koşulları: Çevre sıcaklığında, tehlikeli olmayan kimyasal olarak sevk edilir. Bu ürün, normal nakliye ve Gümrükte geçirilen süre boyunca birkaç hafta için yeterlidir.